C26H29ClN4O2S2 — CID 89090294
N-[2-(4-chlorophenyl)phenyl]-2-[1-(3-methoxypropylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 89090294) has the molecular formula C26H29ClN4O2S2 and a molecular weight of 529.13 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)phenyl]-2-[1-(3-methoxypropylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)phenyl]-2-[1-(3-methoxypropylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89090294 |
| Molecular Formula | C26H29ClN4O2S2 |
| Molecular Weight | 529.13 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)phenyl]-2-[1-(3-methoxypropylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCCNC(=S)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(Cl)cc3)cs2)CC1 |
| InChI | InChI=1S/C26H29ClN4O2S2/c1-33-16-4-13-28-26(34)31-14-11-19(12-15-31)25-30-23(17-35-25)24(32)29-22-6-3-2-5-21(22)18-7-9-20(27)10-8-18/h2-3,5-10,17,19H,4,11-16H2,1H3,(H,28,34)(H,29,32) |
| InChIKey | SJJVVZJGAABTRQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.13 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|