C28H33N3O3S — CID 59209675
butyl 4-[4-[[2-(4-ethylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 59209675) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is butyl 4-[4-[[2-(4-ethylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[4-[[2-(4-ethylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59209675 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | butyl 4-[4-[[2-(4-ethylphenyl)phenyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3-c3ccc(CC)cc3)cs2)CC1 |
| InChI | InChI=1S/C28H33N3O3S/c1-3-5-18-34-28(33)31-16-14-22(15-17-31)27-30-25(19-35-27)26(32)29-24-9-7-6-8-23(24)21-12-10-20(4-2)11-13-21/h6-13,19,22H,3-5,14-18H2,1-2H3,(H,29,32) |
| InChIKey | MKZAWZCTXCZTOV-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|