C28H31N3O3S — CID 72531405
2-(1-hex-4-enoylpiperidin-4-yl)-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 72531405) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-(1-hex-4-enoylpiperidin-4-yl)-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-hex-4-enoylpiperidin-4-yl)-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 72531405 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-(1-hex-4-enoylpiperidin-4-yl)-N-(5-methoxy-2-phenylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC=CCCC(=O)N1CCC(c2nc(C(=O)Nc3cc(OC)ccc3-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C28H31N3O3S/c1-3-4-6-11-26(32)31-16-14-21(15-17-31)28-30-25(19-35-28)27(33)29-24-18-22(34-2)12-13-23(24)20-9-7-5-8-10-20/h3-5,7-10,12-13,18-19,21H,6,11,14-17H2,1-2H3,(H,29,33) |
| InChIKey | HTLZZFJZMIKSBJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|