C24H28N6O3S — CID 59209211
but-3-enyl 4-[4-[[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 59209211) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is but-3-enyl 4-[4-[[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | but-3-enyl 4-[4-[[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59209211 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | but-3-enyl 4-[4-[[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | C=CCCOC(=O)N1CCC(c2nc(C(=O)Nc3cccnc3-n3nc(C)cc3C)cs2)CC1 |
| InChI | InChI=1S/C24H28N6O3S/c1-4-5-13-33-24(32)29-11-8-18(9-12-29)23-27-20(15-34-23)22(31)26-19-7-6-10-25-21(19)30-17(3)14-16(2)28-30/h4,6-7,10,14-15,18H,1,5,8-9,11-13H2,2-3H3,(H,26,31) |
| InChIKey | BODIWBCKOFEGCP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|