C24H32N6OS — CID 59209180
N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 59209180) has the molecular formula C24H32N6OS and a molecular weight of 452.63 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209180 |
| Molecular Formula | C24H32N6OS |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-(1-pentylpiperidin-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CCCCCN1CCC(c2nc(C(=O)Nc3cccnc3-n3nc(C)cc3C)cs2)CC1 |
| InChI | InChI=1S/C24H32N6OS/c1-4-5-6-12-29-13-9-19(10-14-29)24-27-21(16-32-24)23(31)26-20-8-7-11-25-22(20)30-18(3)15-17(2)28-30/h7-8,11,15-16,19H,4-6,9-10,12-14H2,1-3H3,(H,26,31) |
| InChIKey | AMPQXWRNMXDJRR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|