C22H27N7OS2 — CID 59209268
N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 59209268) has the molecular formula C22H27N7OS2 and a molecular weight of 469.64 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59209268 |
| Molecular Formula | C22H27N7OS2 |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]-2-[1-(ethylcarbamothioyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=S)N1CCC(c2nc(C(=O)Nc3cccnc3-n3nc(C)cc3C)cs2)CC1 |
| InChI | InChI=1S/C22H27N7OS2/c1-4-23-22(31)28-10-7-16(8-11-28)21-26-18(13-32-21)20(30)25-17-6-5-9-24-19(17)29-15(3)12-14(2)27-29/h5-6,9,12-13,16H,4,7-8,10-11H2,1-3H3,(H,23,31)(H,25,30) |
| InChIKey | VTAFNKJDEUWUCH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|