C28H41N3O3S — CID 142982967
heptane;N-(2-methylphenyl)-2-[1-(4-oxopentanoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 142982967) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is heptane;N-(2-methylphenyl)-2-[1-(4-oxopentanoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | heptane;N-(2-methylphenyl)-2-[1-(4-oxopentanoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142982967 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | heptane;N-(2-methylphenyl)-2-[1-(4-oxopentanoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)CCC(=O)N1CCC(c2nc(C(=O)Nc3ccccc3C)cs2)CC1.CCCCCCC |
| InChI | InChI=1S/C21H25N3O3S.C7H16/c1-14-5-3-4-6-17(14)22-20(27)18-13-28-21(23-18)16-9-11-24(12-10-16)19(26)8-7-15(2)25;1-3-5-7-6-4-2/h3-6,13,16H,7-12H2,1-2H3,(H,22,27);3-7H2,1-2H3 |
| InChIKey | XHFQSNGEIMURFV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|