C28H37N5O3S — CID 3283647
2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 3283647) has the molecular formula C28H37N5O3S and a molecular weight of 523.70 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3283647 |
| Molecular Formula | C28H37N5O3S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-(2-morpholin-4-ylphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)c1csc(C2CCN(C(=O)NCCC3=CCCCC3)CC2)n1 |
| InChI | InChI=1S/C28H37N5O3S/c34-26(30-23-8-4-5-9-25(23)32-16-18-36-19-17-32)24-20-37-27(31-24)22-11-14-33(15-12-22)28(35)29-13-10-21-6-2-1-3-7-21/h4-6,8-9,20,22H,1-3,7,10-19H2,(H,29,35)(H,30,34) |
| InChIKey | WNCSWAHWFRMFCF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|