C26H30N6O2S2 — CID 3705162
2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 3705162) has the molecular formula C26H30N6O2S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3705162 |
| Molecular Formula | C26H30N6O2S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamoyl]piperidin-4-yl]-N-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2csnn2)cc1)c1csc(C2CCN(C(=O)NCCC3=CCCCC3)CC2)n1 |
| InChI | InChI=1S/C26H30N6O2S2/c33-24(28-21-8-6-19(7-9-21)22-17-36-31-30-22)23-16-35-25(29-23)20-11-14-32(15-12-20)26(34)27-13-10-18-4-2-1-3-5-18/h4,6-9,16-17,20H,1-3,5,10-15H2,(H,27,34)(H,28,33) |
| InChIKey | TUYCBLMYEOIXBS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|