C26H30ClN5O2S2 — CID 3694846
N-[2-(2-chlorophenoxy)ethyl]-2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3694846) has the molecular formula C26H30ClN5O2S2 and a molecular weight of 544.15 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3694846 |
| Molecular Formula | C26H30ClN5O2S2 |
| Molecular Weight | 544.15 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-2-[1-[[4-(dimethylamino)phenyl]carbamothioyl]piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)NCCOc4ccccc4Cl)cs3)CC2)cc1 |
| InChI | InChI=1S/C26H30ClN5O2S2/c1-31(2)20-9-7-19(8-10-20)29-26(35)32-14-11-18(12-15-32)25-30-22(17-36-25)24(33)28-13-16-34-23-6-4-3-5-21(23)27/h3-10,17-18H,11-16H2,1-2H3,(H,28,33)(H,29,35) |
| InChIKey | MBEJDAYFBDFOJI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|