C22H28ClN5O3S2 — CID 3870023
1-[[2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea (PubChem CID 3870023) has the molecular formula C22H28ClN5O3S2 and a molecular weight of 510.09 g/mol. Its IUPAC name is 1-[[2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea.
| Compound Name | 1-[[2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 3870023 |
| Molecular Formula | C22H28ClN5O3S2 |
| Molecular Weight | 510.09 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 1-[[2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea |
| SMILES | CNC(=S)N(C)NC(=O)c1csc(C2CCN(C(=O)C(C)(C)Oc3ccccc3Cl)CC2)n1 |
| InChI | InChI=1S/C22H28ClN5O3S2/c1-22(2,31-17-8-6-5-7-15(17)23)20(30)28-11-9-14(10-12-28)19-25-16(13-33-19)18(29)26-27(4)21(32)24-3/h5-8,13-14H,9-12H2,1-4H3,(H,24,32)(H,26,29) |
| InChIKey | OZQODYAZMOOOOZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.09 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|