C27H29ClN4O5S — CID 3857260
2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-N'-(2-hydroxy-2-phenylacetyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3857260) has the molecular formula C27H29ClN4O5S and a molecular weight of 557.07 g/mol. Its IUPAC name is 2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-N'-(2-hydroxy-2-phenylacetyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-N'-(2-hydroxy-2-phenylacetyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3857260 |
| Molecular Formula | C27H29ClN4O5S |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-[1-[2-(2-chlorophenoxy)-2-methylpropanoyl]piperidin-4-yl]-N'-(2-hydroxy-2-phenylacetyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | CC(C)(Oc1ccccc1Cl)C(=O)N1CCC(c2nc(C(=O)NNC(=O)C(O)c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C27H29ClN4O5S/c1-27(2,37-21-11-7-6-10-19(21)28)26(36)32-14-12-18(13-15-32)25-29-20(16-38-25)23(34)30-31-24(35)22(33)17-8-4-3-5-9-17/h3-11,16,18,22,33H,12-15H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | DNTVQXUPSPGVJM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|