C20H25N5O4S — CID 3695799
tert-butyl 4-[4-[(pyridine-2-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate (PubChem CID 3695799) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is tert-butyl 4-[4-[(pyridine-2-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(pyridine-2-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3695799 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | tert-butyl 4-[4-[(pyridine-2-carbonylamino)carbamoyl]-1,3-thiazol-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(C(=O)NNC(=O)c3ccccn3)cs2)CC1 |
| InChI | InChI=1S/C20H25N5O4S/c1-20(2,3)29-19(28)25-10-7-13(8-11-25)18-22-15(12-30-18)17(27)24-23-16(26)14-6-4-5-9-21-14/h4-6,9,12-13H,7-8,10-11H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | IUULCFZKWNCQFZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|