C22H22ClN5O4S2 — CID 3866651
2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3866651) has the molecular formula C22H22ClN5O4S2 and a molecular weight of 520.04 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3866651 |
| Molecular Formula | C22H22ClN5O4S2 |
| Molecular Weight | 520.04 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-(pyridine-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3nc(C(=O)NNC(=O)c4ccccn4)cs3)CC2)cc1Cl |
| InChI | InChI=1S/C22H22ClN5O4S2/c1-14-5-6-16(12-17(14)23)34(31,32)28-10-7-15(8-11-28)22-25-19(13-33-22)21(30)27-26-20(29)18-4-2-3-9-24-18/h2-6,9,12-13,15H,7-8,10-11H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | CAPHLJJSWJAMGI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.04 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|