C19H23ClN4O5S2 — CID 3694716
ethyl N-[[2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]carbamate (PubChem CID 3694716) has the molecular formula C19H23ClN4O5S2 and a molecular weight of 487.00 g/mol. Its IUPAC name is ethyl N-[[2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]carbamate.
| Compound Name | ethyl N-[[2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 3694716 |
| Molecular Formula | C19H23ClN4O5S2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | ethyl N-[[2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)c1csc(C2CCN(S(=O)(=O)c3ccc(C)c(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C19H23ClN4O5S2/c1-3-29-19(26)23-22-17(25)16-11-30-18(21-16)13-6-8-24(9-7-13)31(27,28)14-5-4-12(2)15(20)10-14/h4-5,10-11,13H,3,6-9H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | DDUOFVXUVHGCAC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|