C21H20ClN5O3S4 — CID 23963634
2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 23963634) has the molecular formula C21H20ClN5O3S4 and a molecular weight of 554.14 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 23963634 |
| Molecular Formula | C21H20ClN5O3S4 |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N-(5-prop-2-ynylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C#CCSc1nnc(NC(=O)c2csc(C3CCN(S(=O)(=O)c4ccc(C)c(Cl)c4)CC3)n2)s1 |
| InChI | InChI=1S/C21H20ClN5O3S4/c1-3-10-31-21-26-25-20(33-21)24-18(28)17-12-32-19(23-17)14-6-8-27(9-7-14)34(29,30)15-5-4-13(2)16(22)11-15/h1,4-5,11-12,14H,6-10H2,2H3,(H,24,25,28) |
| InChIKey | DZYMTRYZOHLMLZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|