C22H23ClN6O5S2 — CID 3873770
2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3873770) has the molecular formula C22H23ClN6O5S2 and a molecular weight of 551.05 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3873770 |
| Molecular Formula | C22H23ClN6O5S2 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.09 |
| IUPAC Name | 2-[1-(3-chloro-4-methylphenyl)sulfonylpiperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3nc(C(=O)NN(C)c4ncccc4[N+](=O)[O-])cs3)CC2)cc1Cl |
| InChI | InChI=1S/C22H23ClN6O5S2/c1-14-5-6-16(12-17(14)23)36(33,34)28-10-7-15(8-11-28)22-25-18(13-35-22)21(30)26-27(2)20-19(29(31)32)4-3-9-24-20/h3-6,9,12-13,15H,7-8,10-11H2,1-2H3,(H,26,30) |
| InChIKey | CCHHQYIZPJDLPG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|