C26H25N7O5S — CID 3831169
2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3831169) has the molecular formula C26H25N7O5S and a molecular weight of 547.60 g/mol. Its IUPAC name is 2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3831169 |
| Molecular Formula | C26H25N7O5S |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N'-methyl-N'-(3-nitro-2-pyridinyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | COc1cc(C(=O)N2CCC(c3nc(C(=O)NN(C)c4ncccc4[N+](=O)[O-])cs3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H25N7O5S/c1-31(23-21(33(36)37)8-5-11-27-23)30-24(34)20-15-39-25(29-20)16-9-12-32(13-10-16)26(35)19-14-22(38-2)17-6-3-4-7-18(17)28-19/h3-8,11,14-16H,9-10,12-13H2,1-2H3,(H,30,34) |
| InChIKey | UPJDXSRBUZBQFT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|