C27H25N5O5S — CID 3745713
2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 3745713) has the molecular formula C27H25N5O5S and a molecular weight of 531.59 g/mol. Its IUPAC name is 2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3745713 |
| Molecular Formula | C27H25N5O5S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-N-[(2-nitrophenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(c3nc(C(=O)NCc4ccccc4[N+](=O)[O-])cs3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C27H25N5O5S/c1-37-24-14-21(29-20-8-4-3-7-19(20)24)27(34)31-12-10-17(11-13-31)26-30-22(16-38-26)25(33)28-15-18-6-2-5-9-23(18)32(35)36/h2-9,14,16-17H,10-13,15H2,1H3,(H,28,33) |
| InChIKey | SLPQSNDNEIPWNB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|