C29H29N5O4S — CID 3863958
N'-(4-ethylbenzoyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide (PubChem CID 3863958) has the molecular formula C29H29N5O4S and a molecular weight of 543.65 g/mol. Its IUPAC name is N'-(4-ethylbenzoyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(4-ethylbenzoyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3863958 |
| Molecular Formula | C29H29N5O4S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | N'-(4-ethylbenzoyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2csc(C3CCN(C(=O)c4cc(OC)c5ccccc5n4)CC3)n2)cc1 |
| InChI | InChI=1S/C29H29N5O4S/c1-3-18-8-10-19(11-9-18)26(35)32-33-27(36)24-17-39-28(31-24)20-12-14-34(15-13-20)29(37)23-16-25(38-2)21-6-4-5-7-22(21)30-23/h4-11,16-17,20H,3,12-15H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | ZFCVZEUKWAXGJB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|