C25H25N5O4S2 — CID 3783715
N-[(2-nitrophenyl)methyl]-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3783715) has the molecular formula C25H25N5O4S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methyl]-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2-nitrophenyl)methyl]-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3783715 |
| Molecular Formula | C25H25N5O4S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | N-[(2-nitrophenyl)methyl]-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | C=CCSc1ncccc1C(=O)N1CCC(c2nc(C(=O)NCc3ccccc3[N+](=O)[O-])cs2)CC1 |
| InChI | InChI=1S/C25H25N5O4S2/c1-2-14-35-24-19(7-5-11-26-24)25(32)29-12-9-17(10-13-29)23-28-20(16-36-23)22(31)27-15-18-6-3-4-8-21(18)30(33)34/h2-8,11,16-17H,1,9-10,12-15H2,(H,27,31) |
| InChIKey | RPEPPSXWKIJNGK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|