C28H30N4O4S2 — CID 3386937
benzyl 2-[[2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]propanoate (PubChem CID 3386937) has the molecular formula C28H30N4O4S2 and a molecular weight of 550.71 g/mol. Its IUPAC name is benzyl 2-[[2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]propanoate.
| Compound Name | benzyl 2-[[2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 3386937 |
| Molecular Formula | C28H30N4O4S2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | benzyl 2-[[2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]propanoate |
| SMILES | C=CCSc1ncccc1C(=O)N1CCC(c2nc(C(=O)NC(C)C(=O)OCc3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C28H30N4O4S2/c1-3-16-37-26-22(10-7-13-29-26)27(34)32-14-11-21(12-15-32)25-31-23(18-38-25)24(33)30-19(2)28(35)36-17-20-8-5-4-6-9-20/h3-10,13,18-19,21H,1,11-12,14-17H2,2H3,(H,30,33) |
| InChIKey | RKELHBDDXRABIJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|