C25H27N5O2S2 — CID 3688052
N'-methyl-N'-phenyl-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide (PubChem CID 3688052) has the molecular formula C25H27N5O2S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-methyl-N'-phenyl-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3688052 |
| Molecular Formula | C25H27N5O2S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N'-methyl-N'-phenyl-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
| SMILES | C=CCSc1ncccc1C(=O)N1CCC(c2nc(C(=O)NN(C)c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C25H27N5O2S2/c1-3-16-33-24-20(10-7-13-26-24)25(32)30-14-11-18(12-15-30)23-27-21(17-34-23)22(31)28-29(2)19-8-5-4-6-9-19/h3-10,13,17-18H,1,11-12,14-16H2,2H3,(H,28,31) |
| InChIKey | JQAOCPNZQDLKIV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|