C24H25N5O4S3 — CID 3695795
N'-(benzenesulfonyl)-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide (PubChem CID 3695795) has the molecular formula C24H25N5O4S3 and a molecular weight of 543.70 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(benzenesulfonyl)-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3695795 |
| Molecular Formula | C24H25N5O4S3 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | N'-(benzenesulfonyl)-2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carbohydrazide |
| SMILES | C=CCSc1ncccc1C(=O)N1CCC(c2nc(C(=O)NNS(=O)(=O)c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C24H25N5O4S3/c1-2-15-34-23-19(9-6-12-25-23)24(31)29-13-10-17(11-14-29)22-26-20(16-35-22)21(30)27-28-36(32,33)18-7-4-3-5-8-18/h2-9,12,16-17,28H,1,10-11,13-15H2,(H,27,30) |
| InChIKey | OOLCBJDDGFHMML-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|