C27H25N5O2S2 — CID 3446704
2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-N-quinolin-6-yl-1,3-thiazole-4-carboxamide (PubChem CID 3446704) has the molecular formula C27H25N5O2S2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-N-quinolin-6-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-N-quinolin-6-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3446704 |
| Molecular Formula | C27H25N5O2S2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 2-[1-(2-prop-2-enylsulfanylpyridine-3-carbonyl)piperidin-4-yl]-N-quinolin-6-yl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCSc1ncccc1C(=O)N1CCC(c2nc(C(=O)Nc3ccc4ncccc4c3)cs2)CC1 |
| InChI | InChI=1S/C27H25N5O2S2/c1-2-15-35-26-21(6-4-12-29-26)27(34)32-13-9-18(10-14-32)25-31-23(17-36-25)24(33)30-20-7-8-22-19(16-20)5-3-11-28-22/h2-8,11-12,16-18H,1,9-10,13-15H2,(H,30,33) |
| InChIKey | YLHYJEZGHDDTOH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|