C26H22FN5O5S — CID 3801042
N-(4-fluoro-3-nitrophenyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3801042) has the molecular formula C26H22FN5O5S and a molecular weight of 535.56 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3801042 |
| Molecular Formula | C26H22FN5O5S |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2-[1-(4-methoxyquinoline-2-carbonyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | COc1cc(C(=O)N2CCC(c3nc(C(=O)Nc4ccc(F)c([N+](=O)[O-])c4)cs3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H22FN5O5S/c1-37-23-13-20(29-19-5-3-2-4-17(19)23)26(34)31-10-8-15(9-11-31)25-30-21(14-38-25)24(33)28-16-6-7-18(27)22(12-16)32(35)36/h2-7,12-15H,8-11H2,1H3,(H,28,33) |
| InChIKey | FRMDKLSUVJCSKC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|