C19H29N5O2S2 — CID 3770311
1-[[2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea (PubChem CID 3770311) has the molecular formula C19H29N5O2S2 and a molecular weight of 423.61 g/mol. Its IUPAC name is 1-[[2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea.
| Compound Name | 1-[[2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 3770311 |
| Molecular Formula | C19H29N5O2S2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[[2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-1,3-thiazole-4-carbonyl]amino]-1,3-dimethylthiourea |
| SMILES | CNC(=S)N(C)NC(=O)c1csc(C2CCN(C(=O)C3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C19H29N5O2S2/c1-20-19(27)23(2)22-16(25)15-12-28-17(21-15)13-8-10-24(11-9-13)18(26)14-6-4-3-5-7-14/h12-14H,3-11H2,1-2H3,(H,20,27)(H,22,25) |
| InChIKey | IATRAERLWIREQD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|