C23H36N6O3S — CID 5015255
2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(1,4-dimethylpiperazine-2-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 5015255) has the molecular formula C23H36N6O3S and a molecular weight of 476.65 g/mol. Its IUPAC name is 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(1,4-dimethylpiperazine-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(1,4-dimethylpiperazine-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 5015255 |
| Molecular Formula | C23H36N6O3S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(1,4-dimethylpiperazine-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | CN1CCN(C)C(C(=O)NNC(=O)c2csc(C3CCN(C(=O)C4CCCCC4)CC3)n2)C1 |
| InChI | InChI=1S/C23H36N6O3S/c1-27-12-13-28(2)19(14-27)21(31)26-25-20(30)18-15-33-22(24-18)16-8-10-29(11-9-16)23(32)17-6-4-3-5-7-17/h15-17,19H,3-14H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | CWRZQUMTOFEAMU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|