C24H30N4O4S — CID 3329153
2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(2-phenoxyacetyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 3329153) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(2-phenoxyacetyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(2-phenoxyacetyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 3329153 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]-N'-(2-phenoxyacetyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(COc1ccccc1)NNC(=O)c1csc(C2CCN(C(=O)C3CCCCC3)CC2)n1 |
| InChI | InChI=1S/C24H30N4O4S/c29-21(15-32-19-9-5-2-6-10-19)26-27-22(30)20-16-33-23(25-20)17-11-13-28(14-12-17)24(31)18-7-3-1-4-8-18/h2,5-6,9-10,16-18H,1,3-4,7-8,11-15H2,(H,26,29)(H,27,30) |
| InChIKey | QFPVCZAWNJRUBS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|