C15H20N2O3 — CID 695727
N'-(2-phenoxyacetyl)cyclohexanecarbohydrazide (PubChem CID 695727) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N'-(2-phenoxyacetyl)cyclohexanecarbohydrazide.
| Compound Name | N'-(2-phenoxyacetyl)cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 695727 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N'-(2-phenoxyacetyl)cyclohexanecarbohydrazide |
| SMILES | O=C(COc1ccccc1)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H20N2O3/c18-14(11-20-13-9-5-2-6-10-13)16-17-15(19)12-7-3-1-4-8-12/h2,5-6,9-10,12H,1,3-4,7-8,11H2,(H,16,18)(H,17,19) |
| InChIKey | MGVHLKNRWWYLGV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|