C21H24N2O3 — CID 4513389
N'-[2-(4-phenylphenoxy)acetyl]cyclohexanecarbohydrazide (PubChem CID 4513389) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N'-[2-(4-phenylphenoxy)acetyl]cyclohexanecarbohydrazide.
| Compound Name | N'-[2-(4-phenylphenoxy)acetyl]cyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 4513389 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N'-[2-(4-phenylphenoxy)acetyl]cyclohexanecarbohydrazide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H24N2O3/c24-20(22-23-21(25)18-9-5-2-6-10-18)15-26-19-13-11-17(12-14-19)16-7-3-1-4-8-16/h1,3-4,7-8,11-14,18H,2,5-6,9-10,15H2,(H,22,24)(H,23,25) |
| InChIKey | RMMONUJNPRSNEG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|