C30H36N6O3S2 — CID 23879410
4-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide (PubChem CID 23879410) has the molecular formula C30H36N6O3S2 and a molecular weight of 592.79 g/mol. Its IUPAC name is 4-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide.
| Compound Name | 4-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 23879410 |
| Molecular Formula | C30H36N6O3S2 |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 4-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]-N-[4-(dimethylamino)phenyl]piperidine-1-carbothioamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)N4CCN(Cc5ccc6c(c5)OCO6)CC4)cs3)CC2)cc1 |
| InChI | InChI=1S/C30H36N6O3S2/c1-33(2)24-6-4-23(5-7-24)31-30(40)36-11-9-22(10-12-36)28-32-25(19-41-28)29(37)35-15-13-34(14-16-35)18-21-3-8-26-27(17-21)39-20-38-26/h3-8,17,19,22H,9-16,18,20H2,1-2H3,(H,31,40) |
| InChIKey | YJHRUCOVAFUCPH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|