C26H35N5O3S2 — CID 4995333
N-[4-(dimethylamino)phenyl]-4-[4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carbothioamide (PubChem CID 4995333) has the molecular formula C26H35N5O3S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-[4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carbothioamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-[4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 4995333 |
| Molecular Formula | C26H35N5O3S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-[4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonyl)-1,3-thiazol-2-yl]piperidine-1-carbothioamide |
| SMILES | CN(C)c1ccc(NC(=S)N2CCC(c3nc(C(=O)N4CCC5(CC4)OCCCO5)cs3)CC2)cc1 |
| InChI | InChI=1S/C26H35N5O3S2/c1-29(2)21-6-4-20(5-7-21)27-25(35)31-12-8-19(9-13-31)23-28-22(18-36-23)24(32)30-14-10-26(11-15-30)33-16-3-17-34-26/h4-7,18-19H,3,8-17H2,1-2H3,(H,27,35) |
| InChIKey | JCGKEYJTRLPUAW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|