C17H24N2O2S — CID 4996601
N-(3,4-dimethylphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carbothioamide (PubChem CID 4996601) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carbothioamide.
| Compound Name | N-(3,4-dimethylphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carbothioamide |
|---|---|
| PubChem CID | 4996601 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1,5-dioxa-9-azaspiro[5.5]undecane-9-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCC3(CC2)OCCCO3)cc1C |
| InChI | InChI=1S/C17H24N2O2S/c1-13-4-5-15(12-14(13)2)18-16(22)19-8-6-17(7-9-19)20-10-3-11-21-17/h4-5,12H,3,6-11H2,1-2H3,(H,18,22) |
| InChIKey | JKDAGESLMSMNKQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|