C18H19ClN2O4S2 — CID 1298458
methyl 3-chloro-6-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbothioylamino)-1-benzothiophene-2-carboxylate (PubChem CID 1298458) has the molecular formula C18H19ClN2O4S2 and a molecular weight of 426.95 g/mol. Its IUPAC name is methyl 3-chloro-6-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbothioylamino)-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbothioylamino)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 1298458 |
| Molecular Formula | C18H19ClN2O4S2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | methyl 3-chloro-6-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbothioylamino)-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)N3CCC4(CC3)OCCO4)ccc2c1Cl |
| InChI | InChI=1S/C18H19ClN2O4S2/c1-23-16(22)15-14(19)12-3-2-11(10-13(12)27-15)20-17(26)21-6-4-18(5-7-21)24-8-9-25-18/h2-3,10H,4-9H2,1H3,(H,20,26) |
| InChIKey | WZEKQMCLIRCYQP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|