C20H19ClN2O4S2 — CID 19680179
methyl 3-chloro-6-[(3,4-dimethoxyphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 19680179) has the molecular formula C20H19ClN2O4S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is methyl 3-chloro-6-[(3,4-dimethoxyphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[(3,4-dimethoxyphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19680179 |
| Molecular Formula | C20H19ClN2O4S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | methyl 3-chloro-6-[(3,4-dimethoxyphenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)NCc3ccc(OC)c(OC)c3)ccc2c1Cl |
| InChI | InChI=1S/C20H19ClN2O4S2/c1-25-14-7-4-11(8-15(14)26-2)10-22-20(28)23-12-5-6-13-16(9-12)29-18(17(13)21)19(24)27-3/h4-9H,10H2,1-3H3,(H2,22,23,28) |
| InChIKey | QITBWMPCQAQNSD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|