C24H27ClN2O2S2 — CID 19675605
methyl 6-[1-(4-butan-2-ylphenyl)propylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19675605) has the molecular formula C24H27ClN2O2S2 and a molecular weight of 475.08 g/mol. Its IUPAC name is methyl 6-[1-(4-butan-2-ylphenyl)propylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 6-[1-(4-butan-2-ylphenyl)propylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19675605 |
| Molecular Formula | C24H27ClN2O2S2 |
| Molecular Weight | 475.08 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | methyl 6-[1-(4-butan-2-ylphenyl)propylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CCC(C)c1ccc(C(CC)NC(=S)Nc2ccc3c(Cl)c(C(=O)OC)sc3c2)cc1 |
| InChI | InChI=1S/C24H27ClN2O2S2/c1-5-14(3)15-7-9-16(10-8-15)19(6-2)27-24(30)26-17-11-12-18-20(13-17)31-22(21(18)25)23(28)29-4/h7-14,19H,5-6H2,1-4H3,(H2,26,27,30) |
| InChIKey | GTPKLTUTOWRVQU-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.08 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|