C20H23ClN2O2S2 — CID 19651497
methyl 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19651497) has the molecular formula C20H23ClN2O2S2 and a molecular weight of 423.00 g/mol. Its IUPAC name is methyl 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19651497 |
| Molecular Formula | C20H23ClN2O2S2 |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | methyl 6-[1-(2-bicyclo[2.2.1]heptanyl)ethylcarbamothioylamino]-3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)NC(C)C3CC4CCC3C4)ccc2c1Cl |
| InChI | InChI=1S/C20H23ClN2O2S2/c1-10(15-8-11-3-4-12(15)7-11)22-20(26)23-13-5-6-14-16(9-13)27-18(17(14)21)19(24)25-2/h5-6,9-12,15H,3-4,7-8H2,1-2H3,(H2,22,23,26) |
| InChIKey | FMPKPKYZTUIPNG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|