C18H14Cl2N2O2S2 — CID 19650060
methyl 3-chloro-6-[(2-chlorophenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 19650060) has the molecular formula C18H14Cl2N2O2S2 and a molecular weight of 425.36 g/mol. Its IUPAC name is methyl 3-chloro-6-[(2-chlorophenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[(2-chlorophenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19650060 |
| Molecular Formula | C18H14Cl2N2O2S2 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | methyl 3-chloro-6-[(2-chlorophenyl)methylcarbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)NCc3ccccc3Cl)ccc2c1Cl |
| InChI | InChI=1S/C18H14Cl2N2O2S2/c1-24-17(23)16-15(20)12-7-6-11(8-14(12)26-16)22-18(25)21-9-10-4-2-3-5-13(10)19/h2-8H,9H2,1H3,(H2,21,22,25) |
| InChIKey | DVDYWUCMVLQFIJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|