C16H17ClN2O2S — CID 800738
1-[(2-chlorophenyl)methyl]-3-(3,5-dimethoxyphenyl)thiourea (PubChem CID 800738) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-(3,5-dimethoxyphenyl)thiourea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-(3,5-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 800738 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-(3,5-dimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)NCc2ccccc2Cl)cc(OC)c1 |
| InChI | InChI=1S/C16H17ClN2O2S/c1-20-13-7-12(8-14(9-13)21-2)19-16(22)18-10-11-5-3-4-6-15(11)17/h3-9H,10H2,1-2H3,(H2,18,19,22) |
| InChIKey | LNXPSLWEXXLCMI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|