C18H21ClN4O2S3 — CID 2211660
methyl 3-chloro-6-[(cyclohexylcarbamothioylamino)carbamothioylamino]-1-benzothiophene-2-carboxylate (PubChem CID 2211660) has the molecular formula C18H21ClN4O2S3 and a molecular weight of 457.05 g/mol. Its IUPAC name is methyl 3-chloro-6-[(cyclohexylcarbamothioylamino)carbamothioylamino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[(cyclohexylcarbamothioylamino)carbamothioylamino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 2211660 |
| Molecular Formula | C18H21ClN4O2S3 |
| Molecular Weight | 457.05 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | methyl 3-chloro-6-[(cyclohexylcarbamothioylamino)carbamothioylamino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=S)NNC(=S)NC3CCCCC3)ccc2c1Cl |
| InChI | InChI=1S/C18H21ClN4O2S3/c1-25-16(24)15-14(19)12-8-7-11(9-13(12)28-15)21-18(27)23-22-17(26)20-10-5-3-2-4-6-10/h7-10H,2-6H2,1H3,(H2,20,22,26)(H2,21,23,27) |
| InChIKey | SUAHJASXIPGYIY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.05 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|