C20H24N2O2S — CID 98222139
1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea (PubChem CID 98222139) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea.
| Compound Name | 1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea |
|---|---|
| PubChem CID | 98222139 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea |
| SMILES | Cc1cc(=O)oc2cc(NC(=S)N[C@H](C)[C@H]3C[C@H]4CC[C@H]3C4)ccc12 |
| InChI | InChI=1S/C20H24N2O2S/c1-11-7-19(23)24-18-10-15(5-6-16(11)18)22-20(25)21-12(2)17-9-13-3-4-14(17)8-13/h5-7,10,12-14,17H,3-4,8-9H2,1-2H3,(H2,21,22,25)/t12-,13+,14+,17-/m1/s1 |
| InChIKey | WJCKIJRHIKLOKZ-XJIUQZFPSA-N |
| XLogP | 4.21 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|