C11H20N2S — CID 98393045
1-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-methylthiourea (PubChem CID 98393045) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 1-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-methylthiourea.
| Compound Name | 1-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-methylthiourea |
|---|---|
| PubChem CID | 98393045 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-[(1R)-1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-3-methylthiourea |
| SMILES | CNC(=S)N[C@H](C)[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C11H20N2S/c1-7(13-11(14)12-2)10-6-8-3-4-9(10)5-8/h7-10H,3-6H2,1-2H3,(H2,12,13,14)/t7-,8-,9-,10+/m1/s1 |
| InChIKey | YUXXYTLPJKIVSN-KYXWUPHJSA-N |
| XLogP | 1.90 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|