C17H21ClN2OS — CID 98290832
N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamothioyl]-2-chlorobenzamide (PubChem CID 98290832) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamothioyl]-2-chlorobenzamide.
| Compound Name | N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamothioyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 98290832 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[[(1R)-1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]carbamothioyl]-2-chlorobenzamide |
| SMILES | C[C@@H](NC(=S)NC(=O)c1ccccc1Cl)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H21ClN2OS/c1-10(14-9-11-6-7-12(14)8-11)19-17(22)20-16(21)13-4-2-3-5-15(13)18/h2-5,10-12,14H,6-9H2,1H3,(H2,19,20,21,22)/t10-,11+,12+,14+/m1/s1 |
| InChIKey | JSWMEEHWSIHRNC-UHXUPSOCSA-N |
| XLogP | 3.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|