C16H20INO — CID 98288356
N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-iodobenzamide (PubChem CID 98288356) has the molecular formula C16H20INO and a molecular weight of 369.25 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-iodobenzamide.
| Compound Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 98288356 |
| Molecular Formula | C16H20INO |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-iodobenzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1I)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H20INO/c1-10(14-9-11-6-7-12(14)8-11)18-16(19)13-4-2-3-5-15(13)17/h2-5,10-12,14H,6-9H2,1H3,(H,18,19)/t10-,11+,12+,14-/m1/s1 |
| InChIKey | PTUYHISFNRTITL-OWTLIXCDSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|