C14H16INO — CID 23306993
N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-iodobenzamide (PubChem CID 23306993) has the molecular formula C14H16INO and a molecular weight of 341.19 g/mol. Its IUPAC name is N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-iodobenzamide.
| Compound Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 23306993 |
| Molecular Formula | C14H16INO |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-iodobenzamide |
| SMILES | O=C(N[C@H]1C[C@@H]2CC[C@@H]1C2)c1ccccc1I |
| InChI | InChI=1S/C14H16INO/c15-12-4-2-1-3-11(12)14(17)16-13-8-9-5-6-10(13)7-9/h1-4,9-10,13H,5-8H2,(H,16,17)/t9-,10-,13+/m1/s1 |
| InChIKey | QGNJPEQQVQHONV-BREBYQMCSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|