C14H18N2O — CID 71624225
2-amino-N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide (PubChem CID 71624225) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-amino-N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide.
| Compound Name | 2-amino-N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide |
|---|---|
| PubChem CID | 71624225 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-amino-N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]benzamide |
| SMILES | Nc1ccccc1C(=O)N[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H18N2O/c15-12-4-2-1-3-11(12)14(17)16-13-8-9-5-6-10(13)7-9/h1-4,9-10,13H,5-8,15H2,(H,16,17)/t9-,10+,13+/m1/s1 |
| InChIKey | NWPREPOJDSJBJV-NRUUGDAUSA-N |
| XLogP | 2.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|