C27H27NO3 — CID 67780844
N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-[bis(4-hydroxyphenyl)methyl]benzamide (PubChem CID 67780844) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-[bis(4-hydroxyphenyl)methyl]benzamide.
| Compound Name | N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-[bis(4-hydroxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 67780844 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-[bis(4-hydroxyphenyl)methyl]benzamide |
| SMILES | O=C(N[C@H]1C[C@@H]2CC[C@H]1C2)c1ccccc1C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H27NO3/c29-21-11-7-18(8-12-21)26(19-9-13-22(30)14-10-19)23-3-1-2-4-24(23)27(31)28-25-16-17-5-6-20(25)15-17/h1-4,7-14,17,20,25-26,29-30H,5-6,15-16H2,(H,28,31)/t17-,20+,25+/m1/s1 |
| InChIKey | KHGOPNJUZDEBBV-AUBMYDRESA-N |
| XLogP | 5.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|