C15H19N3O2S — CID 11919283
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-hydroxybenzoyl)amino]thiourea (PubChem CID 11919283) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-hydroxybenzoyl)amino]thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-hydroxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 11919283 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2-hydroxybenzoyl)amino]thiourea |
| SMILES | O=C(NNC(=S)N[C@@H]1C[C@H]2CC[C@@H]1C2)c1ccccc1O |
| InChI | InChI=1S/C15H19N3O2S/c19-13-4-2-1-3-11(13)14(20)17-18-15(21)16-12-8-9-5-6-10(12)7-9/h1-4,9-10,12,19H,5-8H2,(H,17,20)(H2,16,18,21)/t9-,10+,12+/m0/s1 |
| InChIKey | PFXJPYVDPYYLTI-HOSYDEDBSA-N |
| XLogP | 1.69 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|