C19H21N3O2S — CID 98552547
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(3-hydroxynaphthalene-2-carbonyl)amino]thiourea (PubChem CID 98552547) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(3-hydroxynaphthalene-2-carbonyl)amino]thiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(3-hydroxynaphthalene-2-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 98552547 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(3-hydroxynaphthalene-2-carbonyl)amino]thiourea |
| SMILES | O=C(NNC(=S)N[C@@H]1C[C@H]2CC[C@H]1C2)c1cc2ccccc2cc1O |
| InChI | InChI=1S/C19H21N3O2S/c23-17-10-13-4-2-1-3-12(13)9-15(17)18(24)21-22-19(25)20-16-8-11-5-6-14(16)7-11/h1-4,9-11,14,16,23H,5-8H2,(H,21,24)(H2,20,22,25)/t11-,14-,16+/m0/s1 |
| InChIKey | RZYXNMQTKTXISR-HZUKXOBISA-N |
| XLogP | 2.84 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|